For research use only. Not for therapeutic Use.
Simethicone is an over-the-counter medication commonly used to relieve symptoms of bloating, discomfort, and gas in the digestive tract. It is a mixture of polydimethylsiloxane and silica, which works by reducing the surface tension of gas bubbles in the stomach and intestines, allowing them to combine and be expelled more easily. Simethicone is widely used in antacid formulations and is considered safe for use in adults, children, and infants. It is non-systemic, meaning it does not get absorbed into the bloodstream, and it primarily acts locally within the gastrointestinal tract.
| Catalog Number | R057759 |
| CAS Number | 8050-81-5 |
| Synonyms | Aligest Plus; Antifoam A; DC Antifoam A; Dow Antifoam A; Dow Corning Antifoam A; Espumisan; KS 66; Mylicon; Q 7-2587; Sentry Simethicone GS; Silfoam SE 2; Simiticone; SonoRx; |
| Molecular Formula | C6H18O4Si3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane |
| InChI | InChI=1S/C6H18O2Si2.O2Si/c1-7-10(5,6)8-9(2,3)4;1-3-2/h1-6H3; |
| InChIKey | AMTWCFIAVKBGOD-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C)O[Si](C)(C)C.O=[Si]=O |
