For research use only. Not for therapeutic Use.
Sinapic Acid(Cat No.:R057379)is a naturally occurring hydroxycinnamic acid found in various plants, known for its antioxidant, anti-inflammatory, and antimicrobial properties. As a phenolic compound, it plays a key role in neutralizing free radicals and reducing oxidative stress. Sinapic acid has potential applications in the prevention of chronic diseases like cancer, cardiovascular disorders, and neurodegenerative conditions. Additionally, it exhibits protective effects on the liver and may support skin health. Its bioactive properties make it valuable in both pharmaceutical research and the development of functional foods and cosmetics.
CAS Number | 530-59-6 |
Synonyms | 3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-propenoic Acid; 4-Hydroxy-3,5-?dimethoxycinnamic Acid; 3,5-Dimethoxy-4-hydroxycinnamic Acid; NSC 59261; Sinapinic Acid; Synapitic Acid; |
Molecular Formula | C11H12O5 |
Purity | ≥95% |
Target | Epigenetics |
Storage | Store at +4C |
IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
InChIKey | PCMORTLOPMLEFB-ONEGZZNKSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O |