For research use only. Not for therapeutic Use.
Sinefungin(Cat No.:R025612)is a naturally occurring compound derived from the fermentation of Streptomyces griseus, known for its potent antiviral and antifungal properties. It acts as an adenosylhomocysteinase inhibitor, disrupting S-adenosylmethionine metabolism and impacting various cellular processes, including methylation reactions. Sinefungin has shown effectiveness against a range of viruses and fungi, making it a candidate for antiviral drug development. Additionally, its ability to modulate immune responses has been explored in research related to cancer and autoimmune diseases. Overall, sinefungin serves as a valuable tool for understanding microbial resistance and developing therapeutic interventions.
CAS Number | 58944-73-3 |
Synonyms | 6,9-Diamino-1-(6-amino-9H-purin-9-yl)-1,5,6,7,8,9-hexadeoxy-D-glycero-α-L-talo-decofuranuronic Acid; 32232RP; A 9145; Antibiotic 32232RP; Antibiotic A 9145; Compound 57926; RP 32232? |
Molecular Formula | C15H23N7O5 |
Purity | ≥95% |
Target | Anti-infection |
Storage | 2°C to 8°C |
IUPAC Name | (2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]hexanoic acid |
InChI | InChI=1S/C15H23N7O5/c16-6(1-2-7(17)15(25)26)3-8-10(23)11(24)14(27-8)22-5-21-9-12(18)19-4-20-13(9)22/h4-8,10-11,14,23-24H,1-3,16-17H2,(H,25,26)(H2,18,19,20)/t6-,7-,8+,10+,11+,14+/m0/s1 |
InChIKey | LMXOHSDXUQEUSF-YECHIGJVSA-N |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)C[C@H](CC[C@@H](C(=O)O)N)N)O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |