For research use only. Not for therapeutic Use.
SIRT2-IN-11（Cat No.:I042486）is a selective inhibitor of the Sirtuin 2 (SIRT2) enzyme, which plays a key role in regulating cellular processes such as cell cycle progression, gene expression, and protein deacetylation. SIRT2 is particularly involved in the regulation of microtubules and neuronal function. By inhibiting SIRT2, SIRT2-IN-11 has shown potential therapeutic benefits in neurodegenerative diseases, such as Parkinson’s disease, where dysregulation of SIRT2 activity is implicated in the progression of the disease. Research is ongoing to evaluate its effectiveness in modulating SIRT2 activity for the treatment of neurodegenerative and other related disorders.
| CAS Number | 1005095-06-6 |
| Synonyms | 10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| Molecular Formula | C21H22N2O |
| Purity | ≥95% |
| IUPAC Name | 10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| InChI | InChI=1S/C21H22N2O/c22-21(24)15-8-9-17-16(11-15)18-13-6-7-14(10-13)19(18)20(23-17)12-4-2-1-3-5-12/h1-5,8-9,11,13-14,18-20,23H,6-7,10H2,(H2,22,24) |
| InChIKey | XALTUCOIORLBHQ-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3C2C4=C(C=CC(=C4)C(=O)N)NC3C5=CC=CC=C5 |
