For research use only. Not for therapeutic Use.
SIRT2-IN-9(Cat No.:I042743)is a selective small molecule inhibitor that targets SIRT2, an enzyme belonging to the sirtuin family, which regulates cellular processes such as metabolism, aging, and stress responses. SIRT2 is implicated in various diseases, including neurodegenerative disorders like Parkinson’s disease, due to its role in regulating protein acetylation and cellular homeostasis. By inhibiting SIRT2, SIRT2-IN-9 may modulate these pathways, offering potential therapeutic benefits in treating neurodegeneration and other conditions associated with dysregulated sirtuin activity. Researchers are exploring its use to improve outcomes in diseases where SIRT2 activity contributes to pathology.
CAS Number | 522650-91-5 |
Synonyms | 2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
Molecular Formula | C21H22N6OS2 |
Purity | ≥95% |
IUPAC Name | 2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
InChI | InChI=1S/C21H22N6OS2/c1-2-11-27-15-9-5-3-7-13(15)18-19(27)24-21(26-25-18)29-12-17(28)23-20-22-14-8-4-6-10-16(14)30-20/h3,5,7,9H,2,4,6,8,10-12H2,1H3,(H,22,23,28) |
InChIKey | CTCRADJXWVDTGQ-UHFFFAOYSA-N |
SMILES | CCCN1C2=CC=CC=C2C3=C1N=C(N=N3)SCC(=O)NC4=NC5=C(S4)CCCC5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |