For research use only. Not for therapeutic Use.
Sirtuin modulator 3 (SIRT3)（Cat No.:I042520）is a compound that targets the SIRT3 enzyme, which is part of the sirtuin family involved in cellular regulation. SIRT3 plays a key role in mitochondrial function, energy metabolism, and oxidative stress regulation by deacetylating various mitochondrial proteins. Modulating SIRT3 activity has been explored for its potential in treating age-related diseases, metabolic disorders, and neurodegenerative conditions. By enhancing mitochondrial efficiency and promoting cellular health, SIRT3 modulators are being investigated for their potential therapeutic benefits in conditions like Alzheimer’s disease, diabetes, and cardiovascular diseases.
| CAS Number | 708995-11-3 |
| Synonyms | 3,4,5-trimethoxy-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| Molecular Formula | C24H23N3O4 |
| Purity | ≥95% |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| InChI | InChI=1S/C24H23N3O4/c1-15-8-9-27-14-19(26-22(27)10-15)16-6-5-7-18(11-16)25-24(28)17-12-20(29-2)23(31-4)21(13-17)30-3/h5-14H,1-4H3,(H,25,28) |
| InChIKey | ZCNAQCKPWWPHDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C3=CC(=CC=C3)NC(=O)C4=CC(=C(C(=C4)OC)OC)OC |
