For research use only. Not for therapeutic Use.
SJ-172550(Cat No.:I003540)is a small molecule inhibitor that targets the protein kinase TBK1 (TANK-binding kinase 1), which plays a critical role in regulating immune responses, inflammation, and cell survival. By inhibiting TBK1, SJ-172550 has shown promise in treating diseases associated with excessive inflammation, such as autoimmune disorders, neuroinflammation, and certain cancers. Preclinical studies suggest that it may also have potential in treating conditions like Alzheimer’s disease, where TBK1 is involved in neuroinflammation. Ongoing research aims to evaluate its therapeutic efficacy, safety, and potential for clinical use in various inflammatory and neurodegenerative conditions.
CAS Number | 431979-47-4 |
Synonyms | methyl 2-[2-chloro-6-ethoxy-4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate |
Molecular Formula | C22H21ClN2O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | 10 mM in DMSO |
Storage | Store at 4°C |
IC50 | 0.84 uM(EC50) |
IUPAC Name | methyl 2-[2-chloro-6-ethoxy-4-[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate |
InChI | InChI=1S/C22H21ClN2O5/c1-4-29-19-12-15(11-18(23)21(19)30-13-20(26)28-3)10-17-14(2)24-25(22(17)27)16-8-6-5-7-9-16/h5-12H,4,13H2,1-3H3/b17-10+ |
InChIKey | RKKFQJXGAQWHBZ-LICLKQGHSA-N |
SMILES | CCOC1=C(C(=CC(=C1)/C=C/2\C(=NN(C2=O)C3=CC=CC=C3)C)Cl)OCC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |