For research use only. Not for therapeutic Use.
SKF-75670 hydrobromide（Cat No.:I009506）is a chemical compound primarily used as a research tool in neuropharmacology. It acts as a selective dopamine D1 receptor antagonist and has been studied for its potential effects on dopamine-related pathways in the brain. This compound has been utilized in studies exploring the role of dopamine in neurological disorders such as Parkinson’s disease and schizophrenia. SKF-75670 hydrobromide’s ability to modulate dopaminergic signaling makes it a valuable compound for investigating the mechanisms of neurodegeneration and psychiatric conditions. It is typically used in experimental settings to advance scientific understanding.
| CAS Number | 62717-63-9 |
| Synonyms | 3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
| Molecular Formula | C17H20BrNO2 |
| Purity | ≥95% |
| IUPAC Name | 3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
| InChI | InChI=1S/C17H19NO2.BrH/c1-18-8-7-13-9-16(19)17(20)10-14(13)15(11-18)12-5-3-2-4-6-12;/h2-6,9-10,15,19-20H,7-8,11H2,1H3;1H |
| InChIKey | KWTPHNVUAVFKGB-UHFFFAOYSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)O)O.Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
