For research use only. Not for therapeutic Use.
SKF-96365 hydrochloride (CAT: I001169) is a pharmacological agent that acts as a non-selective inhibitor of store-operated calcium channels (SOCs). It blocks the influx of calcium ions into cells by inhibiting the opening of SOC channels, which are essential for calcium signaling and regulation of various cellular processes. SKF-96365 hydrochloride has been widely used in research to investigate the roles of calcium channels in cellular functions, such as neurotransmission, smooth muscle contraction, immune response, and cell proliferation. It has also been explored as a potential therapeutic target for various conditions, including cardiovascular diseases, neurodegenerative disorders, and cancer.
| Catalog Number | I001169 |
| CAS Number | 130495-35-1 |
| Synonyms | SKF96365 hydrochloride; |
| Molecular Formula | C22H26N2O3 • HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >20 mg/mL in DMSO |
| Storage | Store at RT |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)propoxy]ethyl]imidazole;hydrochloride |
| InChI | InChI=1S/C22H26N2O3.ClH/c1-25-20-9-5-18(6-10-20)4-3-15-27-22(16-24-14-13-23-17-24)19-7-11-21(26-2)12-8-19;/h5-14,17,22H,3-4,15-16H2,1-2H3;1H |
| InChIKey | FWLPKVQUECFKSW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(OCCCC2=CC=C(OC)C=C2)CN3C=NC=C3.Cl |
