For research use only. Not for therapeutic Use.
SLx-2119（Cat No.:I005432）is a selective inhibitor of Rho-associated coiled-coil-containing protein kinase 2 (ROCK2), playing a key role in regulating cytoskeletal dynamics and cellular contraction. By inhibiting ROCK2, SLx-2119 has demonstrated potential in treating diseases associated with fibrosis, inflammation, and vascular disorders. Its selectivity for ROCK2 over ROCK1 reduces the risk of unwanted side effects, making it a promising candidate in clinical trials for conditions like systemic sclerosis and idiopathic pulmonary fibrosis, where aberrant cellular contraction and fibrosis are prevalent.
| Catalog Number | I005432 |
| CAS Number | 911417-87-3 |
| Synonyms | KD-025 |
| Molecular Formula | C26H24N6O2 |
| Purity | 98% |
| Target | TGF-beta/Smad |
| Target Protein | |
| Solubility | DMSO: ≥ 29 mg/mL |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | IC50 ≈ 100 nM and 3 µM for ROCK2 and ROCK1 |
| IUPAC Name | 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| InChI | InChI=1S/C26H24N6O2/c1-16(2)28-24(33)15-34-20-7-5-6-17(13-20)25-30-23-9-4-3-8-21(23)26(31-25)29-19-10-11-22-18(12-19)14-27-32-22/h3-14,16H,15H2,1-2H3,(H,27,32)(H,28,33)(H,29,30,31) |
| InChIKey | GKHIVNAUVKXIIY-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)COC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=N2)NC4=CC5=C(C=C4)NN=C5 |
| Reference | 1: De Silva TM, Kinzenbaw DA, Modrick ML, Reinhardt LD, Faraci FM. Heterogeneous <br> <br> |
