For research use only. Not for therapeutic Use.
SM1-71 is a small-molecule inhibitor designed to target specific signaling pathways involved in disease processes, particularly in cancer and inflammatory diseases. While detailed information on SM1-71 may be limited, compounds of this nature are typically developed to inhibit key proteins or enzymes, such as kinases, that play a role in cell proliferation, survival, or immune response. Research on SM1-71 focuses on its potential therapeutic applications, assessing its efficacy, selectivity, and safety in preclinical models, with the goal of advancing it toward clinical use.
| Catalog Number | I010706 |
| CAS Number | 2088179-99-9 |
| Synonyms | N-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| Molecular Formula | C24H26ClN7O |
| Purity | ≥95% |
| InChI | InChI=1S/C24H26ClN7O/c1-3-22(33)28-20-6-4-5-7-21(20)29-23-19(25)16-26-24(30-23)27-17-8-10-18(11-9-17)32-14-12-31(2)13-15-32/h3-11,16H,1,12-15H2,2H3,(H,28,33)(H2,26,27,29,30) |
| InChIKey | SCMLGVPMSXTUNC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NC(=O)C=C)Cl |
