For research use only. Not for therapeutic Use.
SMANT hydrochloride（Cat No.:R042210）is a small molecule compound used in scientific research, primarily for its ability to modulate specific protein interactions and cellular processes. It acts as a selective inhibitor, targeting key enzymes or signaling pathways involved in the regulation of cellular functions such as growth, survival, and metabolism. SMANT hydrochloride is being studied for its potential therapeutic applications in cancer and other diseases where these cellular processes are dysregulated. Researchers are exploring its effects on tumor progression and its ability to enhance the efficacy of existing treatments in oncology and other therapeutic areas.
| CAS Number | 1177600-74-6 |
| Synonyms | N-(4-bromophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;hydrochloride |
| Molecular Formula | C16H24BrClN2O |
| Purity | ≥95% |
| IUPAC Name | N-(4-bromophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;hydrochloride |
| InChI | InChI=1S/C16H23BrN2O.ClH/c1-12-9-13(2)11-19(10-12)8-7-16(20)18-15-5-3-14(17)4-6-15;/h3-6,12-13H,7-11H2,1-2H3,(H,18,20);1H |
| InChIKey | XQESCHFXROUCOQ-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)CCC(=O)NC2=CC=C(C=C2)Br)C.Cl |
