For research use only. Not for therapeutic Use.
SMIFH2(CAT: I010948) is an inhibitor of formin homology 2 (FH2) domains. It acts by preventing formin-mediated actin nucleation and barbed end elongation. By disrupting formin-dependent actin cytoskeletal structures, SMIFH2 has demonstrated its effectiveness in fission yeast and mammalian NIH 3T3 fibroblasts. This compound is valuable for studying the role of formin proteins in actin dynamics and cellular processes that involve actin cytoskeleton remodeling.
| Catalog Number | I010948 |
| CAS Number | 340316-62-3 |
| Synonyms | 1-(3-Bromophenyl)-5-(2-furanylmethylene)dihydro-2-thioxo-4,6(1H,5H)-pyrimidinedione |
| Molecular Formula | C15H9BrN2O3S |
| Purity | ≥95% |
| Target | Arp2/3 Complex |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | (5E)-1-(3-bromophenyl)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChI | InChI=1S/C15H9BrN2O3S/c16-9-3-1-4-10(7-9)18-14(20)12(13(19)17-15(18)22)8-11-5-2-6-21-11/h1-8H,(H,17,19,22)/b12-8+ |
| InChIKey | MVFJHEQDISFYIS-XYOKQWHBSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C(=O)C(=CC3=CC=CO3)C(=O)NC2=S |
