For research use only. Not for therapeutic Use.
SMO-IN-2（Cat No.:I043335）is a selective inhibitor of Smoothened (SMO), a key protein in the Hedgehog signaling pathway, which regulates cell growth, differentiation, and tissue development. Aberrant activation of the Hedgehog pathway is implicated in various cancers, particularly basal cell carcinoma and medulloblastoma. By inhibiting SMO, SMO-IN-2 disrupts the pathway, potentially blocking tumor growth and metastasis driven by Hedgehog signaling. This compound is being investigated for its therapeutic potential in treating Hedgehog pathway-related cancers, offering a targeted approach to controlling cell proliferation and abnormal tissue growth in these diseases.
| CAS Number | 1822355-27-0 |
| Synonyms | 4-fluoro-N-methyl-N-[1-[2-[(2-methylpyrazol-3-yl)amino]benzoyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| Molecular Formula | C25H25F4N5O2 |
| Purity | ≥95% |
| IUPAC Name | 4-fluoro-N-methyl-N-[1-[2-[(2-methylpyrazol-3-yl)amino]benzoyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| InChI | InChI=1S/C25H25F4N5O2/c1-32(23(35)18-8-7-16(26)15-20(18)25(27,28)29)17-10-13-34(14-11-17)24(36)19-5-3-4-6-21(19)31-22-9-12-30-33(22)2/h3-9,12,15,17,31H,10-11,13-14H2,1-2H3 |
| InChIKey | DGYPDRAGFZNVOC-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)NC2=CC=CC=C2C(=O)N3CCC(CC3)N(C)C(=O)C4=C(C=C(C=C4)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
