For research use only. Not for therapeutic Use.
Smurf1-IN-1(CAT: I040943) is an inhibitor targeting Smurf1 (SMAD specific E3 ubiquitin protein ligase 1), an E3 ubiquitin ligase involved in the regulation of cell signaling pathways such as TGF-β and BMP. Smurf1 plays a critical role in controlling cellular processes like differentiation, proliferation, and apoptosis by mediating the degradation of various substrates. By inhibiting Smurf1, Smurf1-IN-1 can potentially enhance the signaling of these pathways, which may be beneficial in diseases where Smurf1-mediated degradation disrupts normal cellular function. This compound is particularly relevant for research in cancer, fibrosis, and neurological diseases, where Smurf1 activity is implicated in disease progression.
| CAS Number | 1824708-03-3 |
| Synonyms | 1-(2-chloro-4-cyclopropylphenyl)-N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-5-methyltriazole-4-carboxamide |
| Molecular Formula | C24H29ClN6O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(2-chloro-4-cyclopropylphenyl)-N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-5-methyltriazole-4-carboxamide |
| InChI | InChI=1S/C24H29ClN6O2/c1-14-22(24(33)31(29(14)3)18-7-5-4-6-8-18)26-23(32)21-15(2)30(28-27-21)20-12-11-17(13-19(20)25)16-9-10-16/h11-13,16,18H,4-10H2,1-3H3,(H,26,32) |
| InChIKey | DJCHYTWZRDUVHQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2CCCCC2)NC(=O)C3=C(N(N=N3)C4=C(C=C(C=C4)C5CC5)Cl)C |
