For research use only. Not for therapeutic Use.
SN-008, a less active SN-011 analog, can be used as a negative control[1].
| Catalog Number | I045192 |
| CAS Number | 2249106-01-0 |
| Synonyms | N-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-4-phenylbenzamide |
| Molecular Formula | C25H19FN2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C25H19FN2O3S/c26-21-13-15-24(16-14-21)32(30,31)28-23-8-4-7-22(17-23)27-25(29)20-11-9-19(10-12-20)18-5-2-1-3-6-18/h1-17,28H,(H,27,29) |
| InChIKey | GFQARWFKDMDSAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC3=CC(=CC=C3)NS(=O)(=O)C4=CC=C(C=C4)F |
| Reference | [1]. Hong Z, et, al. STING inhibitors target the cyclic dinucleotide binding pocket. Proc Natl Acad Sci U S A. 2021 Jun 15;118(24):e2105465118. |
