For research use only. Not for therapeutic Use.
SN 2 (Cat No.: I004979) is a compound known for its potency as a TRPML3 (Transient Receptor Potential Mucolipin 3) ion channel activator, with an EC50 of 1.8 μM. Additionally, it exhibits remarkable antiviral properties, acting as a potent inhibitor against dengue virus 2 (DENV2) and Zika virus (ZIKV). This dual functionality makes SN 2 valuable in both ion channel research and the development of potential antiviral therapies. If you need to, please contact us in time, and we will reply to you as soon as possible within 24 hours.
| Catalog Number | I004979 |
| CAS Number | 823218-99-1 |
| Synonyms | 3-mesityl-3a,4,5,6,7,7a-hexahydro-4,7-methanobenzo[d]isoxazole |
| Molecular Formula | C17H21NO |
| Purity | ≥95% |
| Target | TRP Channel |
| Solubility | DMSO: ≤ 23.5 mg/mL |
| Storage | 2-8°C |
| IC50 | 1.13 uM (EC50) |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| InChI | InChI=1S/C17H21NO/c1-9-6-10(2)14(11(3)7-9)16-15-12-4-5-13(8-12)17(15)19-18-16/h6-7,12-13,15,17H,4-5,8H2,1-3H3 |
| InChIKey | WKLZNTYMDOPBSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NOC3C2C4CCC3C4)C |
| Reference | <p style=/line-height:25px/> |
