For research use only. Not for therapeutic Use.
SN05（Cat No.:I043555）is a small molecule inhibitor that targets the protein kinase N (PKN), which is involved in regulating several key cellular processes such as cell growth, survival, and stress response. PKN is implicated in various cancer-related pathways, particularly in the regulation of cell migration and metastasis. By inhibiting PKN, SN05 aims to disrupt these oncogenic processes, offering potential therapeutic benefits for cancer treatment. It is being studied for its ability to inhibit tumor progression and metastasis, particularly in cancers where PKN activity plays a crucial role in disease progression.
| CAS Number | 2768663-51-8 |
| Synonyms | (2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid |
| Molecular Formula | C18H17NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C18H17NO4/c20-17(21)16-10-15(11-19-16)23-18(22)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-16,19H,10-11H2,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | GCIZCIZLSHSWDS-HOTGVXAUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)OC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
