For research use only. Not for therapeutic Use.
SN05 is a potent amino acid transport (AAT) inhibitor with Kis of 2.77 μM, 0.73 μM, 0.87 μM, 3.7 μM, 7.25 μM, 7.23 μM and 2.22 μM for human ASCT1, rat ASCT2, human ASCT2, EAAT1, EAAT2, EAAC1 and EAAT5, respectively. SN05 can be used for researching anticancer[1].
| Catalog Number | I043555 |
| CAS Number | 2768663-51-8 |
| Synonyms | (2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid |
| Molecular Formula | C18H17NO4 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H17NO4/c20-17(21)16-10-15(11-19-16)23-18(22)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-16,19H,10-11H2,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | GCIZCIZLSHSWDS-HOTGVXAUSA-N |
| SMILES | C1C(CNC1C(=O)O)OC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
| Reference | [1]. Christof GREWER, et al. Inhibitors of amino acid transport. WO2022087630A1 |
