For research use only. Not for therapeutic Use.
SN40 hydrochloride (Cat No.: I040182) is a synthetic, small-molecule compound that acts as a potent inhibitor of DNA topoisomerase I, an enzyme involved in DNA replication and transcription. By stabilizing the DNA-topoisomerase I complex, SN40 hydrochloride induces DNA damage, leading to cell death, particularly in rapidly dividing cancer cells. This makes it a promising candidate in cancer therapies, particularly for treating solid tumors. Its effectiveness is being evaluated in various preclinical and clinical studies, focusing on its therapeutic potential in oncology.
| CAS Number | 2768663-15-4 |
| Synonyms | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid;hydrochloride |
| Molecular Formula | C18H21ClN2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H20N2O2.ClH/c21-18(22)17-10-16(12-20-17)19-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14;/h1-9,16-17,19-20H,10-12H2,(H,21,22);1H/t16-,17-;/m0./s1 |
| InChIKey | SCVJDDMQQPCHCV-QJHJCNPRSA-N |
| SMILES | C1C(CNC1C(=O)O)NCC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
| Reference | [1]. Grewer Christof, et al. Preparation of amino acids as inhibitors of alanine serine cysteine transporter 2. World Intellectual Property Organization, WO2022087630 A1 2022-04-28 |
