For research use only. Not for therapeutic Use.
SN40 is a potent amino acid transport (AAT) inhibitor with Kis of 7.29 μM, 2.42 μM, 2.94 μM, 5.55 μM, 24.43 μM and 5.55 μM for rat ASCT2, human ASCT2, EAAT1, EAAT2, EAAC1 and EAAT5, respectively. SN40 can be used for researching anticancer[1].
| Catalog Number | I043556 |
| CAS Number | 2768663-14-3 |
| Synonyms | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid |
| Molecular Formula | C18H20N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H20N2O2/c21-18(22)17-10-16(12-20-17)19-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,16-17,19-20H,10-12H2,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | FKDKNHWXEJUEMP-IRXDYDNUSA-N |
| SMILES | C1C(CNC1C(=O)O)NCC2=CC=C(C=C2)C3=CC=CC=C3 |
| Reference | [1]. Grewer Christof, et al. Preparation of amino acids as inhibitors of alanine serine cysteine transporter 2. World Intellectual Property Organization, WO2022087630 A1 2022-04-28 |
