For research use only. Not for therapeutic Use.
Sodium 1H,1H,2H,2H-Perfluorohexane Sulfonate (Cat No.:C001063) is a chemical compound containing a perfluorohexane chain with a sulfonate group, and it exists as a sodium salt. It is a white solid and serves as a surfactant in various applications, including in the production of coatings, firefighting foams, and cleaning agents. This compound exhibits strong hydrophobic and oleophobic properties due to its fluorinated structure, making it valuable in repelling water and oil.
CAS Number | 27619-93-8 |
Synonyms | 3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexanesulfonic Acid Sodium Salt; 4:2 FTS; |
Molecular Formula | C₆H₄F₉NaO₃S |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | Off-White to Pale Brown Solid |
Storage | -20°C, Hygroscopic |
IUPAC Name | sodium;3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate |
InChI | InChI=1S/C6H5F9O3S.Na/c7-3(8,1-2-19(16,17)18)4(9,10)5(11,12)6(13,14)15;/h1-2H2,(H,16,17,18);/q;+1/p-1 |
InChIKey | CQMSUWBKEVEAJG-UHFFFAOYSA-M |
SMILES | C(CS(=O)(=O)[O-])C(C(C(C(F)(F)F)(F)F)(F)F)(F)F.[Na+] |
Reference | Kawase, T., et al.: Journal of Oleo Science, 59, 483-493 (2010); |