For research use only. Not for therapeutic Use.
Sodium 2-(1-carboxylatoethoxy)-1-methyl-2-oxoethyl laurate(Cat No.:M054328) is a complex organic sodium salt derived from lauric acid. This compound is typically used in the formulation of surfactants and detergents due to its excellent emulsifying and foaming properties. It functions by lowering the surface tension between substances, allowing for the effective removal of dirt and oils from surfaces and fabrics. Additionally, its ability to stabilize emulsions makes it useful in personal care products such as shampoos and body washes.
CAS Number | 13557-75-0 |
Molecular Formula | C18H31NaO6 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | sodium;2-(2-dodecanoyloxypropanoyloxy)propanoate |
InChI | InChI=1S/C18H32O6.Na/c1-4-5-6-7-8-9-10-11-12-13-16(19)23-15(3)18(22)24-14(2)17(20)21;/h14-15H,4-13H2,1-3H3,(H,20,21);/q;+1/p-1 |
InChIKey | NTYZDAJPNNBYED-UHFFFAOYSA-M |
SMILES | CCCCCCCCCCCC(=O)OC(C)C(=O)OC(C)C(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |