For research use only. Not for therapeutic Use.
Sodium 2-(1,3-benzothiazol-2-yl)acetate(Cat No.:L007461), is a chemical compound with significant applications in the field of organic synthesis and pharmaceutical research. This compound consists of a sodium cation and the acetate anion attached to a benzothiazole moiety. It is widely used as a reagent in various organic reactions, particularly in the synthesis of complex molecules with pharmaceutical importance. The benzothiazole group imparts unique chemical properties, making it valuable in drug discovery and development. Researchers utilize this compound as a building block to create novel pharmaceutical agents and study their biological activities, contributing to advancements in medicinal chemistry.
CAS Number | 796883-68-6 |
Molecular Formula | C9H6NNaO2S |
Purity | ≥95% |
IUPAC Name | sodium;2-(1,3-benzothiazol-2-yl)acetate |
InChI | InChI=1S/C9H7NO2S.Na/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8;/h1-4H,5H2,(H,11,12);/q;+1/p-1 |
InChIKey | DBXCRJSWFJJURL-UHFFFAOYSA-M |
SMILES | C1=CC=C2C(=C1)N=C(S2)CC(=O)[O-].[Na+] |