For research use only. Not for therapeutic Use.
Sodium 2-((2-Aminoethyl)amino)ethanesulfonate (Cat.No:R035926) is a chemical compound used in various biochemical and pharmaceutical applications. It is a sulfonated amine derivative, known for its buffering properties and as a component in cell culture media. This compound helps maintain a stable pH environment in biological systems, making it valuable in research and medical settings.
CAS Number | 34730-59-1 |
Synonyms | 2-[(2-Aminoethyl)amino]-ethanesulfonic Acid Monosodium Salt;?2-[(2-Aminoethyl)amino]ethanesulfonic Acid Sodium Salt; A 95; EES 200L; N 60; ?N-(2-Aminoethyl)-2-aminoethanesulfonic Acid Sodium Salt; ?N-(2-Sulfoethyl)ethylenediamine Sodium Salt; Sodium |
Molecular Formula | C4H11N2NaO3S |
Purity | ≥95% |
Storage | Store at 4℃ |
IUPAC Name | sodium;2-(2-aminoethylamino)ethanesulfonate |
InChI | InChI=1S/C4H12N2O3S.Na/c5-1-2-6-3-4-10(7,8)9;/h6H,1-5H2,(H,7,8,9);/q;+1/p-1 |
InChIKey | VRRABDXZDGRGPC-UHFFFAOYSA-M |
SMILES | C(CNCCS(=O)(=O)[O-])N.[Na+] |