For research use only. Not for therapeutic Use.
Sodium 2,3-dihydro-1-benzofuran-5-sulfinate(Cat No.:L007351), is a chemical compound of significance in organic synthesis. Its molecular structure contains a benzofuran ring with a sulfinate group (SO2-) attached at the 5-position and a sodium cation for charge balance. This compound is valued for its diverse reactivity, making it a crucial reagent in various chemical transformations. Researchers utilize it in the development of new pharmaceuticals, agrochemicals, and materials due to its ability to participate in important carbon-sulfur bond-forming reactions.
CAS Number | 1859988-99-0 |
Molecular Formula | C8H7NaO3S |
Purity | ≥95% |
IUPAC Name | sodium;2,3-dihydro-1-benzofuran-5-sulfinate |
InChI | InChI=1S/C8H8O3S.Na/c9-12(10)7-1-2-8-6(5-7)3-4-11-8;/h1-2,5H,3-4H2,(H,9,10);/q;+1/p-1 |
InChIKey | PCCKONVRKJWSDK-UHFFFAOYSA-M |
SMILES | C1COC2=C1C=C(C=C2)S(=O)[O-].[Na+] |