For research use only. Not for therapeutic Use.
Sodium 2,3-dihydro-1H-indene-5-sulfinate(Cat No.:L007386), is a chemical compound that plays a significant role in organic synthesis and chemical research. This sodium salt features a sulfinate group (-SO2-) attached to the 5th carbon of a dihydroindene ring. Its unique structure makes it valuable in various chemical transformations, including cross-coupling reactions and the synthesis of complex organic molecules. Researchers use this compound as a versatile building block, enabling the creation of diverse compounds for pharmaceuticals, agrochemicals, and materials.
CAS Number | 153261-83-7 |
Molecular Formula | C9H9NaO2S |
Purity | ≥95% |
IUPAC Name | sodium;2,3-dihydro-1H-indene-5-sulfinate |
InChI | InChI=1S/C9H10O2S.Na/c10-12(11)9-5-4-7-2-1-3-8(7)6-9;/h4-6H,1-3H2,(H,10,11);/q;+1/p-1 |
InChIKey | RBZLUJZZFHCFOH-UHFFFAOYSA-M |
SMILES | C1CC2=C(C1)C=C(C=C2)S(=O)[O-].[Na+] |