For research use only. Not for therapeutic Use.
Sodium 2H-1,3-benzodioxole-5-sulfinate(Cat No.:L007482), is a chemical compound with importance in organic and synthetic chemistry. This compound features a sulfinate group attached to a 2H-1,3-benzodioxole ring, providing opportunities for diverse applications. Researchers utilize it as a valuable reagent in various organic transformations, including cross-coupling reactions and synthesis of complex molecules. Its unique structural features enable the creation of novel chemical entities and contribute to advancements in the field of organic synthesis. Scientists explore its reactivity to design efficient synthetic routes, enabling the development of new materials, pharmaceuticals, and agrochemicals.
CAS Number | 253594-68-2 |
Molecular Formula | C7H5NaO4S |
Purity | ≥95% |
IUPAC Name | sodium;1,3-benzodioxole-5-sulfinate |
InChI | InChI=1S/C7H6O4S.Na/c8-12(9)5-1-2-6-7(3-5)11-4-10-6;/h1-3H,4H2,(H,8,9);/q;+1/p-1 |
InChIKey | XFZNCFPAQMJVPD-UHFFFAOYSA-M |
SMILES | C1OC2=C(O1)C=C(C=C2)S(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |