For research use only. Not for therapeutic Use.
Sodium 3-mercapto-propane sulphonate (Cat No.:M078198), is a chemical compound that contains a sulfonate group (-SO3Na) and a thiol group (-SH). It is used in various applications, including in the pharmaceutical and cosmetic industries. In pharmaceuticals, it may be employed as a reducing agent and stabilizing agent in certain drug formulations. In cosmetics, it can be used in haircare products to reduce the odor associated with sulfur-containing compounds and to improve the overall quality of the product. Sodium 3-mercapto-propane sulphonate is valued for its chemical properties and versatility in different formulations, contributing to the effectiveness and sensory attributes of various products.
CAS Number | 17636-10-1 |
Molecular Formula | C3H7NaO3S2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | sodium;3-sulfanylpropane-1-sulfonate |
InChI | InChI=1S/C3H8O3S2.Na/c4-8(5,6)3-1-2-7;/h7H,1-3H2,(H,4,5,6);/q;+1/p-1 |
InChIKey | FRTIVUOKBXDGPD-UHFFFAOYSA-M |
SMILES | C(CS)CS(=O)(=O)[O-].[Na+] |