Sodium Acetate-1,2-13C2 (Cat No.:C000873) is a stable isotope-labeled form of sodium acetate, a commonly used chemical in various industries. The “-1,2-13C2” in the compound’s name indicates that two carbon atoms in the acetate molecule have been replaced with the stable carbon-13 isotope. Deuterated and isotopically labeled compounds like this are valuable in metabolic and biochemical research, particularly in studies involving NMR spectroscopy and mass spectrometry. Sodium Acetate-1,2-13C2 serves as a reference standard for isotopic tracing and quantification experiments, providing insights into metabolic pathways and carbon fluxes in biological systems.
| Catalog Number | C000873 |
| CAS Number | 56374-56-2 |
| Synonyms | Sodium [13C2]-Acetate; Acetic-13C2 Acid Sodium Salt |
| Molecular Formula | ¹³C₂H₃NaO₂ |
| Purity | 95% |
| Solubility | Methanol (Slightly), Water (Soluble) |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | sodium;acetate |
| InChI | InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i1+1,2+1; |
| InChIKey | VMHLLURERBWHNL-AWQJXPNKSA-M |
| SMILES | CC(=O)[O-].[Na+] |
| Reference | Clayden, J., et al.: Org. Chem., 1st ed. (2001); Zhang, Z. et al.: Org. Lett., 16, 3292 (2014) |
