For research use only. Not for therapeutic Use.
Sodium acrylate is a sodium salt of acrylic acid. This compound is a key component in the production of superabsorbent polymers, widely used in diapers, sanitary napkins, and other absorbent hygiene products. Its ability to absorb and retain large amounts of liquid makes it invaluable in applications requiring moisture control and management.
| Catalog Number | R073937 |
| CAS Number | 7446-81-3 |
| Molecular Formula | (C3H3O2)n·Na |
| Purity | ≥95% |
| IUPAC Name | sodium;prop-2-enoate |
| InChI | InChI=1S/C3H4O2.Na/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| SMILES | C=CC(=O)[O-].[Na+] |
