Sodium ascorbate（Cat No.:A001073） is a salt form of ascorbic acid (Vitamin C) where ascorbic acid is combined with sodium. The addition of sodium increases the pH, making sodium ascorbate less acidic and gentler on the stomach than ascorbic acid, thus improving its gastrointestinal tolerance. Widely used as an antioxidant food additive, it helps prevent oxidation and maintain color, flavor, and nutritional value in foods. In nutritional supplements, sodium ascorbate is favored for its high bioavailability and is also employed in medical treatments to boost vitamin C levels, supporting immune function and collagen synthesis.
| Catalog Number | A001073 |
| CAS Number | 134-03-2 |
| Synonyms | NA |
| Molecular Formula | C6H8O6.Na |
| Purity | ≥95% |
| Storage | 3 years -20°C powder |
| IUPAC Name | sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate |
| InChI | InChI=1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| InChIKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| SMILES | C(C(C1C(=C(C(=O)O1)O)[O-])O)O.[Na+] |
