Sodium Bicarbonate-13C (Cat No.:C000874) is a stable isotope-labeled form of sodium bicarbonate (baking soda). The “-13C” in the compound’s name indicates that the carbon atom in the bicarbonate molecule has been replaced with the stable carbon-13 isotope. Deuterated compounds are widely used as internal standards in analytical chemistry, particularly in nuclear magnetic resonance (NMR) and mass spectrometry. Sodium Bicarbonate-13C serves as a reference compound for quantification and isotopic tracing studies, providing valuable information in various research fields, including metabolic studies, drug metabolism, and carbon cycling in biological systems.
| Catalog Number | C000874 |
| CAS Number | 87081-58-1 |
| Synonyms | Sodium [13C]Bicarbonate; Carbonic-13C Acid Monosodium Salt |
| Molecular Formula | ¹³CHNaO₃ |
| Purity | 95% |
| Solubility | Aqueous Acid (Slightly), Water (Slightly) |
| Storage | RT |
| IUPAC Name | sodium;hydroxyformate |
| InChI | InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1/i1+1; |
| InChIKey | UIIMBOGNXHQVGW-YTBWXGASSA-M |
| SMILES | C(=O)(O)[O-].[Na+] |
| Reference | Chen, A., et al.: U.S. Pat. Appl. Publ., US 20130154637 A1 20130620 (2013) |
