For research use only. Not for therapeutic Use.
Sodium bis(4-nitrophenyl) Phosphate(Cat No.:L007069), is an inorganic compound consisting of sodium ions (Na⁺) and bis(4-nitrophenyl) phosphate anions. This compound is utilized as a spectrophotometric reagent in analytical chemistry for the determination of various cations. Its specific absorbance properties, particularly in the ultraviolet-visible region, allow it to be used as a colorimetric indicator in chemical analysis. Sodium bis(4-nitrophenyl) phosphate plays a significant role in qualitative and quantitative analysis, aiding researchers and analysts in detecting and measuring certain metal ions, contributing to the advancement of research, and ensuring the accuracy of analytical results.
CAS Number | 4043-96-3 |
Molecular Formula | C12H8N2NaO8P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;bis(4-nitrophenyl) phosphate |
InChI | InChI=1S/C12H9N2O8P.Na/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18;/h1-8H,(H,19,20);/q;+1/p-1 |
InChIKey | DELHRHCJGSTQNU-UHFFFAOYSA-M |
SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)([O-])OC2=CC=C(C=C2)[N+](=O)[O-].[Na+] |