For research use only. Not for therapeutic Use.
Sodium butyrate(Cat No.:A001021)is a short-chain fatty acid salt derived from the fermentation of dietary fibers in the gut. It serves as an energy source for colonocytes and plays a crucial role in maintaining gut health. Sodium butyrate is known for its anti-inflammatory and histone deacetylase (HDAC) inhibitory properties, making it a candidate for research in cancer therapy and epigenetic regulation. Its ability to promote apoptosis in cancer cells and enhance intestinal barrier function has garnered interest in the treatment of inflammatory bowel diseases and colorectal cancer. Additionally, sodium butyrate is being explored for its potential neuroprotective effects.
CAS Number | 156-54-7 |
Synonyms | NA |
Molecular Formula | C₄H₇O₂ . Na |
Purity | ≥95% |
Target | Histone deacetylase |
Storage | 3 years -20C powder |
IUPAC Name | sodium;butanoate |
InChI | InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
InChIKey | MFBOGIVSZKQAPD-UHFFFAOYSA-M |
SMILES | CCCC(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |