For research use only. Not for therapeutic Use.
Sodium chloropalladate (Cat.No:L003352) is a significant palladium compound used in various catalytic processes. Its versatile reactivity and stability make it an essential reagent in the field of organometallic chemistry and catalysis, playing a key role in diverse chemical transformations.
CAS Number | 53823-60-2 |
Molecular Formula | Cl6Na2Pd |
Purity | ≥95% |
IUPAC Name | disodium;hexachloropalladium(2-) |
InChI | InChI=1S/6ClH.2Na.Pd/h6*1H;;;/q;;;;;;2*+1;+4/p-6 |
InChIKey | FIKPXZVAWLYQAF-UHFFFAOYSA-H |
SMILES | [Na+].[Na+].Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl |