For research use only. Not for therapeutic Use.
Sodium Dichloromethanesulfonate (Cat No.:C001061) is a chemical compound composed of a sodium cation and a dichloromethanesulfonate anion. It is a white to off-white crystalline solid and serves as a reagent in organic synthesis, particularly as a chlorinating agent. This compound is used in various chemical reactions to introduce chlorine atoms into target molecules. It is of interest in chemical research due to its utility as a mild and selective chlorinating reagent.
| Catalog Number | C001061 |
| CAS Number | 53638-47-4 |
| Synonyms | 1,1 -Dichloro-methanesulfonic Acid Sodium Salt |
| Molecular Formula | CHCl₂NaO₃S |
| Purity | ≥95% |
| Solubility | Methanol (Slightly), Water (Sparingly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Hygroscopic |
| IUPAC Name | sodium;dichloromethanesulfonate |
| InChI | InChI=1S/CH2Cl2O3S.Na/c2-1(3)7(4,5)6;/h1H,(H,4,5,6);/q;+1/p-1 |
| InChIKey | DYDWFIFRPXYWEC-UHFFFAOYSA-M |
| SMILES | C(S(=O)(=O)[O-])(Cl)Cl.[Na+] |
| Reference | Silhanek, J., et al.: Int. J. Sulfur Chem., 8, 423 (1973) |
