For research use only. Not for therapeutic Use.
Sodium dimethyldithiocarbamate (Cat.No:M069155) is a chemical compound widely used as a chelating agent, a vulcanization accelerator in the rubber industry, and a pesticide in agriculture. It forms stable complexes with heavy metals, making it valuable for wastewater treatment and as a component in dithiocarbamate-based pesticides.
| Catalog Number | M069155 |
| CAS Number | 128-04-1 |
| Molecular Formula | C3H6NNaS2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | sodium;N,N-dimethylcarbamodithioate |
| InChI | InChI=1S/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | VMSRVIHUFHQIAL-UHFFFAOYSA-M |
| SMILES | CN(C)C(=S)[S-].[Na+] |
