Sodium glucoheptonate is a water-soluble organic compound derived from glucose. As a chelating agent, it forms stable complexes with metal ions, making it valuable in various industrial applications. Its ability to sequester metal ions effectively inhibits their precipitation and deposition, preventing scale formation in water treatment systems and enhancing the efficiency of detergents and cleaning solutions. Additionally, sodium glucoheptonate finds use in the textile, agriculture, and food industries. Its biodegradability and low toxicity contribute to its wide acceptance as an environmentally friendly alternative to conventional chelating agents.
| Catalog Number | R067720 |
| CAS Number | 31138-65-5 |
| Synonyms | Sodium glucoheptonate |
| Molecular Formula | C7H13O8Na |
| Purity | ≥95% |
| IUPAC Name | sodium;(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI | InChI=1S/C7H14O8.Na/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2-6,8-13H,1H2,(H,14,15);/q;+1/p-1/t2-,3-,4+,5-,6-;/m1./s1 |
| InChIKey | FMYOMWCQJXWGEN-WYRLRVFGSA-M |
| SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |
