Sodium gluconate（Cat No.:A000667） is the sodium salt of gluconic acid, produced by fermentation of glucose. It is a white, crystalline, highly soluble compound widely used in the pharmaceutical, cosmetic, food, and construction industries. As a chelating agent, it efficiently binds with calcium, iron, and other metals, making it useful in preventing mineral deposition. In the pharmaceutical sector, it serves as an electrolyte replenisher and a pH regulator. In construction, sodium gluconate is added to cement formulations to improve workability and delay setting time. Its biodegradable nature also makes it an environmentally friendly choice in various applications.
| Catalog Number | A000667 |
| CAS Number | 527-07-1 |
| Synonyms | 527-07-1 |
| Molecular Formula | C6H11O7.Na |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI | InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | UPMFZISCCZSDND-JJKGCWMISA-M |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
