For research use only. Not for therapeutic Use.
Sodium iodoacetate (Cat No.:L007010) is a chemical compound commonly used in biochemical research and as a pesticide. It is a white crystalline powder. Sodium iodoacetate is an irreversible inhibitor of enzymes containing sulfhydryl groups, including glyceraldehyde-3-phosphate dehydrogenase. This inhibition disrupts key metabolic pathways, making it valuable in studying enzyme function. Additionally, it acts as an herbicide and fungicide, inhibiting plant growth by interfering with essential enzymatic processes.
CAS Number | 305-53-3 |
Molecular Formula | C2H2INaO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;2-iodoacetate |
InChI | InChI=1S/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
InChIKey | AGDSCTQQXMDDCV-UHFFFAOYSA-M |
SMILES | C(C(=O)[O-])I.[Na+] |