For research use only. Not for therapeutic Use.
Sodium of polyaspartic acid (Cat.No:M037114) is a water-soluble biopolymer derived from aspartic acid. It exhibits excellent chelating and dispersing properties, making it valuable in various industrial applications, including water treatment, agriculture, and personal care products. This compound contributes to environmental sustainability due to its biodegradability and low toxicity.
| Catalog Number | M037114 |
| CAS Number | 181828-06-8 |
| Synonyms | Sodium of Polyaspartic Acid |
| Molecular Formula | C4H6NO3(C4H4NO3Na)m(C4H5NO3)nC4H6NO4 |
| Purity | ≥95% |
| Storage | Store at -20C |
