For research use only. Not for therapeutic Use.
Sodium oleate(Cat No.:M071552), also known as oleic acid sodium, is the sodium salt of a monounsaturated fatty acid commonly present in human adipocytes and various tissues. It serves as an activator of the Na+/K+ ATPase enzyme, which is essential for maintaining the electrochemical gradient across cell membranes. By enhancing Na+/K+ ATPase activity, sodium oleate contributes to cellular ion homeostasis and membrane potential regulation. This property has implications in various physiological processes and may be relevant in understanding the role of fatty acids in cellular function and metabolism.
Catalog Number | M071552 |
CAS Number | 143-19-1 |
Molecular Formula | C18H33NaO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;(Z)-octadec-9-enoate |
InChI | InChI=1S/C18H34O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b10-9-; |
InChIKey | BCKXLBQYZLBQEK-KVVVOXFISA-M |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)[O-].[Na+] |