For research use only. Not for therapeutic Use.
Sodium Perfluoro-1-decane sulfonate （Cat No.:C001058）, is a synthetic anionic surfactant with the chemical formula C10F21NaO3S. It possesses strong hydrophobic properties due to its fluorinated structure. This compound finds applications in various industries, including surface coatings, oil, and water repellents, and wetting agents. However, perfluoroalkyl substances, including Sodium Perfluoro-1-decane sulfonate, have raised environmental concerns due to their persistence and potential bioaccumulation.
| Catalog Number | C001058 |
| CAS Number | 2806-15-7 |
| Synonyms | Sodium Perfluorodecanesulfonate; 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heneicosafluoro-1-decanesulfonic Acid Sodium Salt; L-PFDS |
| Molecular Formula | C₁₀F₂₁NaO₃S |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Pale Yellow to Pale Brown Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | sodium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonate |
| InChI | InChI=1S/C10HF21O3S.Na/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)35(32,33)34;/h(H,32,33,34);/q;+1/p-1 |
| InChIKey | ULYIJZHWHDXAMG-UHFFFAOYSA-M |
| SMILES | C(C(C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F.[Na+] |
| Reference | Lorenzo, M., et al.: Anal. Bioanal. Chem., 407, 5767 (2015) |
