For research use only. Not for therapeutic Use.
Sodium pyrimidine-2-sulfinate (Cat.No:L004192) is a significant chemical compound with versatile applications. Its structure, containing a pyrimidine ring and sulfinate group, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with various applications in pharmaceutical and chemical research.
Catalog Number | L004192 |
CAS Number | 2188151-68-8 |
Molecular Formula | C4H3N2NaO2S |
Purity | ≥95% |
IUPAC Name | sodium;pyrimidine-2-sulfinate |
InChI | InChI=1S/C4H4N2O2S.Na/c7-9(8)4-5-2-1-3-6-4;/h1-3H,(H,7,8);/q;+1/p-1 |
InChIKey | YFKHXLGPONXLRC-UHFFFAOYSA-M |
SMILES | C1=CN=C(N=C1)S(=O)[O-].[Na+] |