For research use only. Not for therapeutic Use.
Sodium Tauroursodeoxycholate (TUDC)(Cat No.:A000108)is a water-soluble bile acid formed from ursodeoxycholic acid (UDCA) conjugated with taurine. It is known for its role in promoting bile flow and protecting bile duct cells from bile acid toxicity, making it valuable in treating liver diseases such as cholestatic conditions where bile flow is impaired. TUDC is also recognized for its anti-apoptotic and cytoprotective properties, offering potential therapeutic benefits in conditions like cystic fibrosis and neurodegenerative diseases. Additionally, it is used in research settings to study bile acid signaling and cellular protection mechanisms.
CAS Number | 35807-85-3 |
Synonyms | NA |
Molecular Formula | C26H44NNaO6S |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | Store at -20C |
IUPAC Name | sodium;2-[[(4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate |
InChI | InChI=1S/C26H45NO6S.Na/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29;/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33);/q;+1/p-1/t16-,17+,18-,19-,20+,21+,22+,24+,25+,26-;/m1./s1 |
InChIKey | IYPNVUSIMGAJFC-JUWYWQLMSA-M |
SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C.[Na+] |