Sodium Trifluoroacetate-13C2(Cat No.:R055218) is an isotopically labeled compound, enriched with two carbon-13 atoms, enhancing its utility in various chemical and environmental studies. This compound is pivotal for tracing chemical reactions involving trifluoroacetate, especially in studies focused on atmospheric chemistry and environmental pollutants. Its stable isotopic labeling allows for precise quantification and analysis of volatile organic compounds in environmental samples using mass spectrometry. Sodium Trifluoroacetate-13C2 is essential for researchers studying the environmental impact of fluorinated compounds and developing strategies to mitigate their effects on ecosystems.
Catalog Number | R055218 |
CAS Number | 1794767-05-7 |
Synonyms | Trifluoroacetic Acid-13C2 Sodium Salt; Sodium Trifluoromethanecarboxylate-13C2; Sodium Trifluoroacetic Acid Salt-13C2 |
Molecular Formula | C2F3NaO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | sodium;2,2,2-trifluoroacetate |
InChI | InChI=1S/C2HF3O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1/i1+1,2+1; |
InChIKey | UYCAUPASBSROMS-AWQJXPNKSA-M |
SMILES | [13C](=O)([13C](F)(F)F)[O-].[Na+] |