For research use only. Not for therapeutic Use.
Solasodine (Cat No.: I001052) is a naturally occurring steroidal alkaloid found in plants like Solanum species, including eggplant. It has shown various pharmacological properties, including anticancer, anti-inflammatory, and antidiabetic effects. Solasodine is often explored for its potential use in synthesizing steroidal compounds and in the development of therapeutic agents for diseases such as cancer and diabetes. It may also help in modulating immune responses and promoting cell growth regulation. However, further research is needed to fully understand its clinical benefits and safety.
| Catalog Number | I001052 |
| CAS Number | 126-17-0 |
| Molecular Formula | C27H43NO2 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | DMSO: ＜ 4.4 mg/mL |
| Storage | -20℃ |
| IC50 | 12.17 ± 3.3 uM (Hela cell line)[1] |
| IUPAC Name | (1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-ol |
| InChI | 1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | KWVISVAMQJWJSZ-VKROHFNGSA-N |
| SMILES | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O)C)C)C)NC1 |
| Reference | [1]. Sarthak Bhattacharya, et al. Isolation of Solasodine from the Unripe Fruits of Solanum xanthocarpum Schrad and Wendl.(Solanaceae) and it’s Anti Cancer Activity against Hela and U937 Cell Lines. |
