For research use only. Not for therapeutic Use.
Solvent Orange 60(Cat No.:M174204) is a synthetic dye belonging to the class of azo dyes. It is a soluble dye, often used in organic solvents rather than water. This dye is known for its vivid orange color and is commonly used in various applications, including inks, plastics, and textiles. Solvent Orange 60 is valued for its high tinting strength, which means a small amount of dye can produce a strong color. However, like many azo dyes, it can pose environmental and health risks, and efforts are being made to find safer alternatives.
CAS Number | 6925-69-5 |
Molecular Formula | C18H10N2O |
Purity | ≥95% |
IUPAC Name | 2,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),4,6,8,10,12,14,16(20),17-nonaen-3-one |
InChI | InChI=1S/C18H10N2O/c21-18-13-8-2-1-7-12(13)17-19-14-9-3-5-11-6-4-10-15(16(11)14)20(17)18/h1-10H |
InChIKey | XFYQEBBUVNLYBR-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=NC4=CC=CC5=C4C(=CC=C5)N3C2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |