For research use only. Not for therapeutic Use.
Sophocarpine Monohydrate(CAT: R063793) is a compound derived from Sophora flavescens, a traditional Chinese medicinal herb. It possesses diverse pharmacological properties and has been investigated for its potential therapeutic applications. Sophocarpine is recognized for its anti-inflammatory, anti-oxidative, and anti-tumor effects. It has been studied as a candidate for treating various diseases, including cardiovascular conditions due to its potential to regulate lipid metabolism and reduce oxidative stress. Additionally, sophocarpine’s impact on immune responses and its ability to modulate cytokine production make it a subject of interest in immunological research.
CAS Number | 145572-44-7 |
Synonyms | 1H,5H,10H-Dipyrido[2,1-f:3’,2’,1’-ij][1,6]naphthyridine Matridin-15-one deriv.; 13,14-Didehydromatridin-15-one Monohydrate |
Molecular Formula | C₁₅H₂₂N₂O•H₂O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate |
InChI | 1S/C15H22N2O.H2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14;/h1,7,11-13,15H,2-6,8-10H2;1H2/t11-,12+,13+,15-;/m0./s1 |
InChIKey | FBOREIYHDGYUFA-PUILLJIJSA-N |
SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4.O |