For research use only. Not for therapeutic Use.
Sophoraflavanone G(CAT: R064394) is a naturally occurring prenylated flavonoid primarily isolated from the roots of Sophora species. Known for its wide range of biological activities, it exhibits potent antimicrobial, anti-inflammatory, and anticancer properties. Research shows that it has the ability to inhibit key signaling pathways such as NF-κB, making it a promising candidate for drug development targeting inflammation and cancer. Its antibacterial activity, particularly against drug-resistant strains like MRSA, highlights its therapeutic potential. Sophoraflavanone G is also being explored for its role in inhibiting the growth of various cancer cell lines, indicating its importance in ongoing pharmaceutical research.
Catalog Number | R064394 |
CAS Number | 97938-30-2 |
Molecular Formula | C25H28O6 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2S)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3/t15-,23+/m1/s1 |
InChIKey | XRYVAQQLDYTHCL-CMJOXMDJSA-N |
SMILES | CC(=CCC(CC1=C(C=C(C2=C1OC(CC2=O)C3=C(C=C(C=C3)O)O)O)O)C(=C)C)C |